N-{4-[5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]phenyl}-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
N-{4-[5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]phenyl}-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
N-{4-[5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]phenyl}-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | Y501-5409 |
| Compound Name: | N-{4-[5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]phenyl}-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 470.45 |
| Molecular Formula: | C24 H21 F3 N4 O3 |
| Smiles: | COc1ccccc1C1CC(C(Nc2ccc(cc2)n2c(cc(C(F)(F)F)n2)C2CC2)=O)ON=1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7191 |
| logD: | 4.719 |
| logSw: | -4.5725 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.9 |
| InChI Key: | SLEXCMFPGDGIJI-NRFANRHFSA-N |