5-{[(naphthalen-2-yl)oxy]methyl}furan-2-carbohydrazide
Chemical Structure Depiction of
5-{[(naphthalen-2-yl)oxy]methyl}furan-2-carbohydrazide
5-{[(naphthalen-2-yl)oxy]methyl}furan-2-carbohydrazide
Compound characteristics
| Compound ID: | Y501-6498 |
| Compound Name: | 5-{[(naphthalen-2-yl)oxy]methyl}furan-2-carbohydrazide |
| Molecular Weight: | 282.3 |
| Molecular Formula: | C16 H14 N2 O3 |
| Smiles: | C(c1ccc(C(NN)=O)o1)Oc1ccc2ccccc2c1 |
| Stereo: | ACHIRAL |
| logP: | 2.5197 |
| logD: | 2.5195 |
| logSw: | -3.1874 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 63.941 |
| InChI Key: | KAGLMPJIJKYNOE-UHFFFAOYSA-N |