3-[(4-ethoxyphenoxy)methyl]benzohydrazide
Chemical Structure Depiction of
3-[(4-ethoxyphenoxy)methyl]benzohydrazide
3-[(4-ethoxyphenoxy)methyl]benzohydrazide
Compound characteristics
| Compound ID: | Y501-6528 |
| Compound Name: | 3-[(4-ethoxyphenoxy)methyl]benzohydrazide |
| Molecular Weight: | 286.33 |
| Molecular Formula: | C16 H18 N2 O3 |
| Smiles: | CCOc1ccc(cc1)OCc1cccc(c1)C(NN)=O |
| Stereo: | ACHIRAL |
| logP: | 2.348 |
| logD: | 2.3479 |
| logSw: | -2.8336 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 63.495 |
| InChI Key: | WONSEVKBGPCPNN-UHFFFAOYSA-N |