5-[(2-chloro-6-methylphenoxy)methyl]-N'-(1-cyclopropylethylidene)furan-2-carbohydrazide
Chemical Structure Depiction of
5-[(2-chloro-6-methylphenoxy)methyl]-N'-(1-cyclopropylethylidene)furan-2-carbohydrazide
5-[(2-chloro-6-methylphenoxy)methyl]-N'-(1-cyclopropylethylidene)furan-2-carbohydrazide
Compound characteristics
| Compound ID: | Y501-7181 |
| Compound Name: | 5-[(2-chloro-6-methylphenoxy)methyl]-N'-(1-cyclopropylethylidene)furan-2-carbohydrazide |
| Molecular Weight: | 346.81 |
| Molecular Formula: | C18 H19 Cl N2 O3 |
| Smiles: | C/C(C1CC1)=N/NC(c1ccc(COc2c(C)cccc2[Cl])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6639 |
| logD: | 4.6627 |
| logSw: | -4.6436 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.607 |
| InChI Key: | FRUMASQOXVXQAD-UHFFFAOYSA-N |