3-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}-N-{1-[(3-fluorophenyl)methyl]-1H-pyrazol-3-yl}benzamide
Chemical Structure Depiction of
3-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}-N-{1-[(3-fluorophenyl)methyl]-1H-pyrazol-3-yl}benzamide
3-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}-N-{1-[(3-fluorophenyl)methyl]-1H-pyrazol-3-yl}benzamide
Compound characteristics
| Compound ID: | Y501-7351 |
| Compound Name: | 3-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}-N-{1-[(3-fluorophenyl)methyl]-1H-pyrazol-3-yl}benzamide |
| Molecular Weight: | 441.5 |
| Molecular Formula: | C27 H24 F N3 O2 |
| Smiles: | C1Cc2ccc(cc2C1)OCc1cccc(c1)C(Nc1ccn(Cc2cccc(c2)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5185 |
| logD: | 5.4362 |
| logSw: | -5.7859 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.799 |
| InChI Key: | NFMDGTAJZDUGRX-UHFFFAOYSA-N |