1-(5-bromothiophen-2-yl)-3-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one
Chemical Structure Depiction of
1-(5-bromothiophen-2-yl)-3-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one
1-(5-bromothiophen-2-yl)-3-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one
Compound characteristics
| Compound ID: | Y501-8805 |
| Compound Name: | 1-(5-bromothiophen-2-yl)-3-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one |
| Molecular Weight: | 311.2 |
| Molecular Formula: | C12 H11 Br N2 O S |
| Smiles: | Cc1c(/C=C/C(c2ccc(s2)[Br])=O)cn(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.908 |
| logD: | 2.908 |
| logSw: | -3.0722 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 29.3941 |
| InChI Key: | SAWXWMJXJZTVSY-UHFFFAOYSA-N |