3-[chloro(difluoro)methyl]-6-phenyl-7-[(thiophen-2-yl)methylidene]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
Chemical Structure Depiction of
3-[chloro(difluoro)methyl]-6-phenyl-7-[(thiophen-2-yl)methylidene]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
3-[chloro(difluoro)methyl]-6-phenyl-7-[(thiophen-2-yl)methylidene]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
Compound characteristics
| Compound ID: | Y502-0239 |
| Compound Name: | 3-[chloro(difluoro)methyl]-6-phenyl-7-[(thiophen-2-yl)methylidene]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| Molecular Weight: | 394.85 |
| Molecular Formula: | C16 H9 Cl F2 N4 S2 |
| Smiles: | C(=C1/C(c2ccccc2)=Nn2c(C(F)(F)[Cl])nnc2S1)\c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 4.7874 |
| logD: | 4.7866 |
| logSw: | -5.0611 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.174 |
| InChI Key: | SWROKIWOMTWVQR-UHFFFAOYSA-N |