(1-ethyl-4-nitro-1H-pyrazol-3-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(1-ethyl-4-nitro-1H-pyrazol-3-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
(1-ethyl-4-nitro-1H-pyrazol-3-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | Y502-0290 |
| Compound Name: | (1-ethyl-4-nitro-1H-pyrazol-3-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone |
| Molecular Weight: | 397.35 |
| Molecular Formula: | C17 H18 F3 N5 O3 |
| Smiles: | CCn1cc(c(C(N2CCN(CC2)c2cccc(c2)C(F)(F)F)=O)n1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.3709 |
| logD: | 2.3709 |
| logSw: | -2.5563 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 68.276 |
| InChI Key: | BVONWUGEZDQHKL-UHFFFAOYSA-N |