N-(3-chloro-4-fluorophenyl)-2-({4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-2-({4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl}sulfanyl)acetamide
N-(3-chloro-4-fluorophenyl)-2-({4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | Y502-0381 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-2-({4-[4-(difluoromethoxy)phenyl]pyrimidin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 439.84 |
| Molecular Formula: | C19 H13 Cl F3 N3 O2 S |
| Smiles: | C(C(Nc1ccc(c(c1)[Cl])F)=O)Sc1nccc(c2ccc(cc2)OC(F)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.9892 |
| logD: | 4.9815 |
| logSw: | -5.2602 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.175 |
| InChI Key: | WGHPGUNZNNCZSJ-UHFFFAOYSA-N |