7-(2,6-difluorobenzamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Chemical Structure Depiction of
7-(2,6-difluorobenzamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
7-(2,6-difluorobenzamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Compound characteristics
| Compound ID: | Y502-0536 |
| Compound Name: | 7-(2,6-difluorobenzamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Molecular Weight: | 354.33 |
| Molecular Formula: | C15 H12 F2 N2 O4 S |
| Smiles: | CC1CSC2C(C(N2C=1C(O)=O)=O)NC(c1c(cccc1F)F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 1.4959 |
| logD: | -3.4009 |
| logSw: | -2.1982 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.718 |
| InChI Key: | FHBYUEYAUPXULO-UHFFFAOYSA-N |