3-[4-(difluoromethoxy)phenyl]-1-(1-ethyl-5-methyl-1H-pyrazol-4-yl)prop-2-en-1-one
Chemical Structure Depiction of
3-[4-(difluoromethoxy)phenyl]-1-(1-ethyl-5-methyl-1H-pyrazol-4-yl)prop-2-en-1-one
3-[4-(difluoromethoxy)phenyl]-1-(1-ethyl-5-methyl-1H-pyrazol-4-yl)prop-2-en-1-one
Compound characteristics
| Compound ID: | Y502-1089 |
| Compound Name: | 3-[4-(difluoromethoxy)phenyl]-1-(1-ethyl-5-methyl-1H-pyrazol-4-yl)prop-2-en-1-one |
| Molecular Weight: | 306.31 |
| Molecular Formula: | C16 H16 F2 N2 O2 |
| Smiles: | CCn1c(C)c(cn1)C(/C=C/c1ccc(cc1)OC(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9385 |
| logD: | 2.9385 |
| logSw: | -3.1757 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.744 |
| InChI Key: | KEHMUAOLGXCIQQ-UHFFFAOYSA-N |