N-(4,6-dimethyl-2-oxopyridin-1(2H)-yl)-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-(4,6-dimethyl-2-oxopyridin-1(2H)-yl)-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide
N-(4,6-dimethyl-2-oxopyridin-1(2H)-yl)-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | Y502-1614 |
| Compound Name: | N-(4,6-dimethyl-2-oxopyridin-1(2H)-yl)-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
| Molecular Weight: | 382.41 |
| Molecular Formula: | C21 H22 N2 O5 |
| Smiles: | CCOc1ccc(cc1)OCc1ccc(C(NN2C(C)=CC(C)=CC2=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.2434 |
| logD: | 3.2256 |
| logSw: | -3.3247 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.299 |
| InChI Key: | TYRFZTPTXKDGOH-UHFFFAOYSA-N |