1-[(2-bromo-4-chlorophenoxy)methyl]-N-(2-fluorophenyl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
1-[(2-bromo-4-chlorophenoxy)methyl]-N-(2-fluorophenyl)-1H-pyrazole-3-carboxamide
1-[(2-bromo-4-chlorophenoxy)methyl]-N-(2-fluorophenyl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | Y502-2595 |
| Compound Name: | 1-[(2-bromo-4-chlorophenoxy)methyl]-N-(2-fluorophenyl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 424.65 |
| Molecular Formula: | C17 H12 Br Cl F N3 O2 |
| Smiles: | C(n1ccc(C(Nc2ccccc2F)=O)n1)Oc1ccc(cc1[Br])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4377 |
| logD: | 4.4369 |
| logSw: | -4.6997 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.082 |
| InChI Key: | IKVBRDNHHHUQSY-UHFFFAOYSA-N |