5-(2,4-dichlorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(2,4-dichlorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}-1,2-oxazole-3-carboxamide
5-(2,4-dichlorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | Y502-3090 |
| Compound Name: | 5-(2,4-dichlorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 490.32 |
| Molecular Formula: | C20 H13 Cl2 N5 O4 S |
| Smiles: | c1cnc(NS(c2ccc(cc2)NC(c2cc(c3ccc(cc3[Cl])[Cl])on2)=O)(=O)=O)nc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6196 |
| logD: | 2.8643 |
| logSw: | -4.2321 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 106.084 |
| InChI Key: | WZYGBOAPWLIYNW-UHFFFAOYSA-N |