N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-2,3-dimethoxybenzamide
Chemical Structure Depiction of
N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-2,3-dimethoxybenzamide
N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-2,3-dimethoxybenzamide
Compound characteristics
| Compound ID: | Y502-3237 |
| Compound Name: | N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-2,3-dimethoxybenzamide |
| Molecular Weight: | 372.81 |
| Molecular Formula: | C18 H17 Cl N4 O3 |
| Smiles: | COc1cccc(C(Nc2ncn(Cc3ccc(cc3)[Cl])n2)=O)c1OC |
| Stereo: | ACHIRAL |
| logP: | 3.1076 |
| logD: | 2.7015 |
| logSw: | -3.6471 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.899 |
| InChI Key: | YVISWXXIWAPAIP-UHFFFAOYSA-N |