N-(adamantan-1-yl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-(adamantan-1-yl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide
N-(adamantan-1-yl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | Y502-3630 |
| Compound Name: | N-(adamantan-1-yl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| Molecular Weight: | 423.41 |
| Molecular Formula: | C22 H21 F4 N O3 |
| Smiles: | [H][C@@]12C[C@@]3([H])C[C@@]([H])(C1)C[C@@](C2)(C3)NC(c1ccc(COc2c(c(cc(c2F)F)F)F)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5919 |
| logD: | 5.5919 |
| logSw: | -5.8326 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.59 |
| InChI Key: | VFEPDXBSAUMFRV-UHFFFAOYSA-N |