N-(1,3-dimethyl-1H-pyrazol-4-yl)-N'-(3-methoxyphenyl)thiourea
Chemical Structure Depiction of
N-(1,3-dimethyl-1H-pyrazol-4-yl)-N'-(3-methoxyphenyl)thiourea
N-(1,3-dimethyl-1H-pyrazol-4-yl)-N'-(3-methoxyphenyl)thiourea
Compound characteristics
| Compound ID: | Y502-3679 |
| Compound Name: | N-(1,3-dimethyl-1H-pyrazol-4-yl)-N'-(3-methoxyphenyl)thiourea |
| Molecular Weight: | 276.36 |
| Molecular Formula: | C13 H16 N4 O S |
| Smiles: | Cc1c(cn(C)n1)NC(Nc1cccc(c1)OC)=S |
| Stereo: | ACHIRAL |
| logP: | 2.1285 |
| logD: | 2.1285 |
| logSw: | -2.5233 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.069 |
| InChI Key: | BBOAEZFQOBTQBU-UHFFFAOYSA-N |