2-(cyclohexylamino)-2-oxoethyl 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoate
Chemical Structure Depiction of
2-(cyclohexylamino)-2-oxoethyl 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoate
2-(cyclohexylamino)-2-oxoethyl 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoate
Compound characteristics
| Compound ID: | Y502-3851 |
| Compound Name: | 2-(cyclohexylamino)-2-oxoethyl 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoate |
| Molecular Weight: | 421.85 |
| Molecular Formula: | C18 H23 Cl F3 N3 O3 |
| Smiles: | C1CCC(CC1)NC(COC(CCn1c(C2CC2)c(c(C(F)(F)F)n1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9247 |
| logD: | 3.9247 |
| logSw: | -4.473 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.704 |
| InChI Key: | LPYQTTMEFDSSLM-UHFFFAOYSA-N |