3-(2,5-dimethoxyphenyl)-1-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one
Chemical Structure Depiction of
3-(2,5-dimethoxyphenyl)-1-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one
3-(2,5-dimethoxyphenyl)-1-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one
Compound characteristics
| Compound ID: | Y502-4051 |
| Compound Name: | 3-(2,5-dimethoxyphenyl)-1-(1,3-dimethyl-1H-pyrazol-4-yl)prop-2-en-1-one |
| Molecular Weight: | 286.33 |
| Molecular Formula: | C16 H18 N2 O3 |
| Smiles: | Cc1c(cn(C)n1)C(/C=C/c1cc(ccc1OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2491 |
| logD: | 2.2491 |
| logSw: | -2.7825 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 43.55 |
| InChI Key: | ANKIUGBILQURQW-UHFFFAOYSA-N |