N-[3-(4-chloro-3-methyl-1H-pyrazol-1-yl)propyl]-3,5-dimethoxybenzamide
Chemical Structure Depiction of
N-[3-(4-chloro-3-methyl-1H-pyrazol-1-yl)propyl]-3,5-dimethoxybenzamide
N-[3-(4-chloro-3-methyl-1H-pyrazol-1-yl)propyl]-3,5-dimethoxybenzamide
Compound characteristics
| Compound ID: | Y502-5339 |
| Compound Name: | N-[3-(4-chloro-3-methyl-1H-pyrazol-1-yl)propyl]-3,5-dimethoxybenzamide |
| Molecular Weight: | 337.8 |
| Molecular Formula: | C16 H20 Cl N3 O3 |
| Smiles: | Cc1c(cn(CCCNC(c2cc(cc(c2)OC)OC)=O)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.1765 |
| logD: | 2.1765 |
| logSw: | -3.2792 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.689 |
| InChI Key: | JTYWAZCJWGTKPW-UHFFFAOYSA-N |