N-(adamantan-2-yl)-N'-(2-methoxyethyl)thiourea
Chemical Structure Depiction of
N-(adamantan-2-yl)-N'-(2-methoxyethyl)thiourea
N-(adamantan-2-yl)-N'-(2-methoxyethyl)thiourea
Compound characteristics
| Compound ID: | Y502-6209 |
| Compound Name: | N-(adamantan-2-yl)-N'-(2-methoxyethyl)thiourea |
| Molecular Weight: | 268.42 |
| Molecular Formula: | C14 H24 N2 O S |
| Smiles: | COCCNC(NC1C2CC3CC(C2)CC1C3)=S |
| Stereo: | ACHIRAL |
| logP: | 2.9958 |
| logD: | 2.9958 |
| logSw: | -3.1739 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 30.5073 |
| InChI Key: | KTCLUWNYHFZIME-UHFFFAOYSA-N |