2-{4-[(2-chloro-5-methylphenoxy)methyl]benzoyl}-N-[3-(diethylamino)propyl]hydrazine-1-carbothioamide
Chemical Structure Depiction of
2-{4-[(2-chloro-5-methylphenoxy)methyl]benzoyl}-N-[3-(diethylamino)propyl]hydrazine-1-carbothioamide
2-{4-[(2-chloro-5-methylphenoxy)methyl]benzoyl}-N-[3-(diethylamino)propyl]hydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | Y502-7562 |
| Compound Name: | 2-{4-[(2-chloro-5-methylphenoxy)methyl]benzoyl}-N-[3-(diethylamino)propyl]hydrazine-1-carbothioamide |
| Molecular Weight: | 463.04 |
| Molecular Formula: | C23 H31 Cl N4 O2 S |
| Smiles: | CCN(CC)CCCNC(NNC(c1ccc(COc2cc(C)ccc2[Cl])cc1)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 4.2458 |
| logD: | 4.2458 |
| logSw: | -4.5446 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 59.327 |
| InChI Key: | WKXJUZWYCQQUJC-UHFFFAOYSA-N |