N-{1-[(3,4-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-{1-[(3,4-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-4-methylbenzene-1-sulfonamide
N-{1-[(3,4-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y502-7602 |
| Compound Name: | N-{1-[(3,4-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 397.28 |
| Molecular Formula: | C16 H14 Cl2 N4 O2 S |
| Smiles: | Cc1ccc(cc1)S(Nc1ncn(Cc2ccc(c(c2)[Cl])[Cl])n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2306 |
| logD: | 2.3095 |
| logSw: | -4.3299 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.11 |
| InChI Key: | GWAIJPXAMMIWNC-UHFFFAOYSA-N |