4-chloro-N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}benzene-1-sulfonamide
4-chloro-N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y502-7826 |
| Compound Name: | 4-chloro-N-{1-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-3-yl}benzene-1-sulfonamide |
| Molecular Weight: | 383.25 |
| Molecular Formula: | C15 H12 Cl2 N4 O2 S |
| Smiles: | C(c1ccc(cc1)[Cl])n1cnc(NS(c2ccc(cc2)[Cl])(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.6795 |
| logD: | 1.3416 |
| logSw: | -4.1094 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.11 |
| InChI Key: | SNHWXIASPIWBAY-UHFFFAOYSA-N |