1-[(2-methylphenyl)methyl]-4-(naphthalene-2-sulfonyl)piperazine
Chemical Structure Depiction of
1-[(2-methylphenyl)methyl]-4-(naphthalene-2-sulfonyl)piperazine
1-[(2-methylphenyl)methyl]-4-(naphthalene-2-sulfonyl)piperazine
Compound characteristics
| Compound ID: | Y502-8354 |
| Compound Name: | 1-[(2-methylphenyl)methyl]-4-(naphthalene-2-sulfonyl)piperazine |
| Molecular Weight: | 380.51 |
| Molecular Formula: | C22 H24 N2 O2 S |
| Smiles: | Cc1ccccc1CN1CCN(CC1)S(c1ccc2ccccc2c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.581 |
| logD: | 4.5768 |
| logSw: | -4.741 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 35.218 |
| InChI Key: | PVUVDOCZLQPNAM-UHFFFAOYSA-N |