1-(4-chlorobenzene-1-sulfonyl)-4-{[3-(trifluoromethyl)phenyl]methyl}piperazine
Chemical Structure Depiction of
1-(4-chlorobenzene-1-sulfonyl)-4-{[3-(trifluoromethyl)phenyl]methyl}piperazine
1-(4-chlorobenzene-1-sulfonyl)-4-{[3-(trifluoromethyl)phenyl]methyl}piperazine
Compound characteristics
| Compound ID: | Y502-8664 |
| Compound Name: | 1-(4-chlorobenzene-1-sulfonyl)-4-{[3-(trifluoromethyl)phenyl]methyl}piperazine |
| Molecular Weight: | 418.86 |
| Molecular Formula: | C18 H18 Cl F3 N2 O2 S |
| Smiles: | C1CN(CCN1Cc1cccc(c1)C(F)(F)F)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0412 |
| logD: | 4.0404 |
| logSw: | -4.5177 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 35.49 |
| InChI Key: | KGKRSUODSRVGMQ-UHFFFAOYSA-N |