(2-chloro-4-nitrophenyl)[4-(2-ethoxyphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(2-chloro-4-nitrophenyl)[4-(2-ethoxyphenyl)piperazin-1-yl]methanone
(2-chloro-4-nitrophenyl)[4-(2-ethoxyphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | Y502-9953 |
| Compound Name: | (2-chloro-4-nitrophenyl)[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 389.84 |
| Molecular Formula: | C19 H20 Cl N3 O4 |
| Smiles: | CCOc1ccccc1N1CCN(CC1)C(c1ccc(cc1[Cl])[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6359 |
| logD: | 3.6359 |
| logSw: | -4.1111 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 60.438 |
| InChI Key: | JJVDAZMEQQPHOE-UHFFFAOYSA-N |