ethyl 2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
					Chemical Structure Depiction of
ethyl 2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
			ethyl 2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y503-0030 | 
| Compound Name: | ethyl 2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate | 
| Molecular Weight: | 253.36 | 
| Molecular Formula: | C13 H19 N O2 S | 
| Smiles: | CCC1CCc2c(C(=O)OCC)c(N)sc2C1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 3.5881 | 
| logD: | 3.5881 | 
| logSw: | -4.0617 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 42.189 | 
| InChI Key: | KECVYBAUBFEMBT-MRVPVSSYSA-N | 
 
				 
				