ethyl 2-[(bicyclo[2.2.1]heptane-2-carbonyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-[(bicyclo[2.2.1]heptane-2-carbonyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate
ethyl 2-[(bicyclo[2.2.1]heptane-2-carbonyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y503-0431 |
| Compound Name: | ethyl 2-[(bicyclo[2.2.1]heptane-2-carbonyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| Molecular Weight: | 406.54 |
| Molecular Formula: | C21 H30 N2 O4 S |
| Smiles: | CCN(CC)C(c1c(C)c(C(=O)OCC)c(NC(C2CC3CCC2C3)=O)s1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.9656 |
| logD: | 1.5907 |
| logSw: | -4.2553 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.654 |
| InChI Key: | UYZFELGGXDXOHW-UHFFFAOYSA-N |