N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-ethylphenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-ethylphenyl)quinoline-4-carboxamide
N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-ethylphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y503-0611 |
| Compound Name: | N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-ethylphenyl)quinoline-4-carboxamide |
| Molecular Weight: | 465.62 |
| Molecular Formula: | C29 H27 N3 O S |
| Smiles: | CCC1CCc2c(C#N)c(NC(c3cc(c4ccc(CC)cc4)nc4ccccc34)=O)sc2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 8.1218 |
| logD: | 7.1666 |
| logSw: | -6.0367 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.16 |
| InChI Key: | OPFIEZLJHBVNLN-LJQANCHMSA-N |