ethyl 5-(dimethylcarbamoyl)-4-methyl-2-(3,4,5-triethoxybenzamido)thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-(dimethylcarbamoyl)-4-methyl-2-(3,4,5-triethoxybenzamido)thiophene-3-carboxylate
ethyl 5-(dimethylcarbamoyl)-4-methyl-2-(3,4,5-triethoxybenzamido)thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y503-0757 |
| Compound Name: | ethyl 5-(dimethylcarbamoyl)-4-methyl-2-(3,4,5-triethoxybenzamido)thiophene-3-carboxylate |
| Molecular Weight: | 492.59 |
| Molecular Formula: | C24 H32 N2 O7 S |
| Smiles: | CCOC(c1c(C)c(C(N(C)C)=O)sc1NC(c1cc(c(c(c1)OCC)OCC)OCC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9696 |
| logD: | 1.4337 |
| logSw: | -3.278 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.596 |
| InChI Key: | XGACEHSGJRTLRA-UHFFFAOYSA-N |