2-nitro-N'-[phenyl(pyridin-4-yl)methylidene]benzohydrazide
Chemical Structure Depiction of
2-nitro-N'-[phenyl(pyridin-4-yl)methylidene]benzohydrazide
2-nitro-N'-[phenyl(pyridin-4-yl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | Y503-0990 |
| Compound Name: | 2-nitro-N'-[phenyl(pyridin-4-yl)methylidene]benzohydrazide |
| Molecular Weight: | 346.34 |
| Molecular Formula: | C19 H14 N4 O3 |
| Smiles: | c1ccc(cc1)\C(c1ccncc1)=N/NC(c1ccccc1[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9018 |
| logD: | 2.1783 |
| logSw: | -3.6841 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.31 |
| InChI Key: | MKBUHDVZKIGBCB-UHFFFAOYSA-N |