3-(pentafluoroethyl)-1-phenyl-1H-pyrazol-5-ol
Chemical Structure Depiction of
3-(pentafluoroethyl)-1-phenyl-1H-pyrazol-5-ol
3-(pentafluoroethyl)-1-phenyl-1H-pyrazol-5-ol
Compound characteristics
| Compound ID: | Y503-3147 |
| Compound Name: | 3-(pentafluoroethyl)-1-phenyl-1H-pyrazol-5-ol |
| Molecular Weight: | 278.18 |
| Molecular Formula: | C11 H7 F5 N2 O |
| Smiles: | c1ccc(cc1)n1c(cc(C(C(F)(F)F)(F)F)n1)O |
| Stereo: | ACHIRAL |
| logP: | 3.1205 |
| logD: | 1.9937 |
| logSw: | -3.0865 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.8042 |
| InChI Key: | MFKSUMFKAUQTFZ-UHFFFAOYSA-N |