3-(furan-2-yl)-1-phenyl-1H-pyrazol-5-ol
Chemical Structure Depiction of
3-(furan-2-yl)-1-phenyl-1H-pyrazol-5-ol
3-(furan-2-yl)-1-phenyl-1H-pyrazol-5-ol
Compound characteristics
| Compound ID: | Y503-3148 |
| Compound Name: | 3-(furan-2-yl)-1-phenyl-1H-pyrazol-5-ol |
| Molecular Weight: | 226.23 |
| Molecular Formula: | C13 H10 N2 O2 |
| Smiles: | c1ccc(cc1)n1c(cc(c2ccco2)n1)O |
| Stereo: | ACHIRAL |
| logP: | 2.3281 |
| logD: | 0.0009 |
| logSw: | -2.2064 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.111 |
| InChI Key: | LJWKEOLULDABCT-UHFFFAOYSA-N |