N-[2-(cyclohex-1-en-1-yl)ethyl]-N'-cyclopropylthiourea
Chemical Structure Depiction of
N-[2-(cyclohex-1-en-1-yl)ethyl]-N'-cyclopropylthiourea
N-[2-(cyclohex-1-en-1-yl)ethyl]-N'-cyclopropylthiourea
Compound characteristics
| Compound ID: | Y503-4139 |
| Compound Name: | N-[2-(cyclohex-1-en-1-yl)ethyl]-N'-cyclopropylthiourea |
| Molecular Weight: | 224.37 |
| Molecular Formula: | C12 H20 N2 S |
| Smiles: | C1CCC(CCNC(NC2CC2)=S)=CC1 |
| Stereo: | ACHIRAL |
| logP: | 2.4325 |
| logD: | 2.4325 |
| logSw: | -2.2375 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 21.7952 |
| InChI Key: | VKQKJCKGAFDSRR-UHFFFAOYSA-N |