ethyl 2-[(1-benzofuran-2-carbonyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-[(1-benzofuran-2-carbonyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
ethyl 2-[(1-benzofuran-2-carbonyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y504-5300 |
| Compound Name: | ethyl 2-[(1-benzofuran-2-carbonyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| Molecular Weight: | 397.49 |
| Molecular Formula: | C22 H23 N O4 S |
| Smiles: | CCC1CCc2c(C(=O)OCC)c(NC(c3cc4ccccc4o3)=O)sc2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.0743 |
| logD: | 2.694 |
| logSw: | -6.4748 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.091 |
| InChI Key: | ZNARRSQPEVJEAP-CYBMUJFWSA-N |