4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-b]pyridine
Chemical Structure Depiction of
4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-b]pyridine
4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-b]pyridine
Compound characteristics
| Compound ID: | Y504-6584 |
| Compound Name: | 4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-b]pyridine |
| Molecular Weight: | 423.46 |
| Molecular Formula: | C24 H23 F2 N3 O2 |
| Smiles: | Cc1ccc(Cn2c3c(c(cc(c4ccc(c(c4)OC)OC)n3)C(F)F)c(C)n2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8879 |
| logD: | 4.8739 |
| logSw: | -4.9098 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.487 |
| InChI Key: | LAXRHXQFFFUWRW-UHFFFAOYSA-N |