10-methyl-2-(thiophen-2-yl)-8-(trifluoromethyl)pyrido[2',3':3,4]pyrazolo[1,5-a]pyrimidine-4-carboxylic acid
Chemical Structure Depiction of
10-methyl-2-(thiophen-2-yl)-8-(trifluoromethyl)pyrido[2',3':3,4]pyrazolo[1,5-a]pyrimidine-4-carboxylic acid
10-methyl-2-(thiophen-2-yl)-8-(trifluoromethyl)pyrido[2',3':3,4]pyrazolo[1,5-a]pyrimidine-4-carboxylic acid
Compound characteristics
| Compound ID: | Y504-7413 |
| Compound Name: | 10-methyl-2-(thiophen-2-yl)-8-(trifluoromethyl)pyrido[2',3':3,4]pyrazolo[1,5-a]pyrimidine-4-carboxylic acid |
| Molecular Weight: | 378.33 |
| Molecular Formula: | C16 H9 F3 N4 O2 S |
| Smiles: | Cc1cc(C(F)(F)F)nc2c1c1nc(cc(C(O)=O)n1n2)c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 3.8477 |
| logD: | -2.0859 |
| logSw: | -4.0858 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.027 |
| InChI Key: | NDWIYZNJRXQNGO-UHFFFAOYSA-N |