N-[(furan-2-yl)methyl]-1-methyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-1-methyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide
N-[(furan-2-yl)methyl]-1-methyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | Y504-8173 |
| Compound Name: | N-[(furan-2-yl)methyl]-1-methyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide |
| Molecular Weight: | 329.3 |
| Molecular Formula: | C13 H10 F3 N3 O2 S |
| Smiles: | Cn1c2c(cc(C(NCc3ccco3)=O)s2)c(C(F)(F)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.7576 |
| logD: | 2.7576 |
| logSw: | -3.2035 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.79 |
| InChI Key: | ZWIDKKSOXPRPQH-UHFFFAOYSA-N |