N-(2,5-dimethoxyphenyl)-6-(furan-2-yl)-3-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-6-(furan-2-yl)-3-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide
N-(2,5-dimethoxyphenyl)-6-(furan-2-yl)-3-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | Y504-9646 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-6-(furan-2-yl)-3-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 379.37 |
| Molecular Formula: | C20 H17 N3 O5 |
| Smiles: | Cc1c2c(cc(c3ccco3)nc2on1)C(Nc1cc(ccc1OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4322 |
| logD: | 3.4292 |
| logSw: | -4.1155 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.907 |
| InChI Key: | MYAIVGITABUJTE-UHFFFAOYSA-N |