3-(2-fluorophenyl)-N-hexyl-6-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
3-(2-fluorophenyl)-N-hexyl-6-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide
3-(2-fluorophenyl)-N-hexyl-6-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | Y505-0488 |
| Compound Name: | 3-(2-fluorophenyl)-N-hexyl-6-methyl[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 355.41 |
| Molecular Formula: | C20 H22 F N3 O2 |
| Smiles: | CCCCCCNC(c1cc(C)nc2c1c(c1ccccc1F)no2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7392 |
| logD: | 4.7392 |
| logSw: | -4.6692 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.288 |
| InChI Key: | XYFYOEWFDGIVBO-UHFFFAOYSA-N |