N-(3-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
N-(3-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | Y505-0691 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 408.86 |
| Molecular Formula: | C22 H18 Cl F N4 O |
| Smiles: | Cc1c(cccc1[Cl])NC(c1cc(C)nc2c1c(C)nn2c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9282 |
| logD: | 4.9168 |
| logSw: | -4.9521 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.834 |
| InChI Key: | RBLMCMGLMCTJRZ-UHFFFAOYSA-N |