N-(3,4-dimethylphenyl)-1-methyl-6-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-1-methyl-6-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
N-(3,4-dimethylphenyl)-1-methyl-6-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | Y505-0743 |
| Compound Name: | N-(3,4-dimethylphenyl)-1-methyl-6-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 356.43 |
| Molecular Formula: | C22 H20 N4 O |
| Smiles: | Cc1ccc(cc1C)NC(c1cc(c2ccccc2)nc2c1cnn2C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1347 |
| logD: | 5.1347 |
| logSw: | -4.928 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.522 |
| InChI Key: | NBSPOXMNANGEMV-UHFFFAOYSA-N |