4-(3-methoxyphenyl)-N-methyl-N-[(1-methyl-1H-pyrazol-5-yl)methyl]-6-(trifluoromethyl)pyrimidin-2-amine
Chemical Structure Depiction of
4-(3-methoxyphenyl)-N-methyl-N-[(1-methyl-1H-pyrazol-5-yl)methyl]-6-(trifluoromethyl)pyrimidin-2-amine
4-(3-methoxyphenyl)-N-methyl-N-[(1-methyl-1H-pyrazol-5-yl)methyl]-6-(trifluoromethyl)pyrimidin-2-amine
Compound characteristics
| Compound ID: | Y505-1459 |
| Compound Name: | 4-(3-methoxyphenyl)-N-methyl-N-[(1-methyl-1H-pyrazol-5-yl)methyl]-6-(trifluoromethyl)pyrimidin-2-amine |
| Molecular Weight: | 377.37 |
| Molecular Formula: | C18 H18 F3 N5 O |
| Smiles: | CN(Cc1ccnn1C)c1nc(cc(C(F)(F)F)n1)c1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.7823 |
| logD: | 3.7234 |
| logSw: | -4.1036 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 42.095 |
| InChI Key: | TVDZQKUYRYKMQV-UHFFFAOYSA-N |