N-(2,6-diethylphenyl)-5-fluorothiophene-2-sulfonamide
Chemical Structure Depiction of
N-(2,6-diethylphenyl)-5-fluorothiophene-2-sulfonamide
N-(2,6-diethylphenyl)-5-fluorothiophene-2-sulfonamide
Compound characteristics
| Compound ID: | Y505-3359 |
| Compound Name: | N-(2,6-diethylphenyl)-5-fluorothiophene-2-sulfonamide |
| Molecular Weight: | 313.41 |
| Molecular Formula: | C14 H16 F N O2 S2 |
| Smiles: | CCc1cccc(CC)c1NS(c1ccc(F)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3038 |
| logD: | 4.3021 |
| logSw: | -4.285 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.511 |
| InChI Key: | OHJSYUYMXGJDQZ-UHFFFAOYSA-N |