N'-[(5-fluorothiophen-2-yl)methylidene]-1-methyl-1H-pyrazole-3-carbohydrazide
Chemical Structure Depiction of
N'-[(5-fluorothiophen-2-yl)methylidene]-1-methyl-1H-pyrazole-3-carbohydrazide
N'-[(5-fluorothiophen-2-yl)methylidene]-1-methyl-1H-pyrazole-3-carbohydrazide
Compound characteristics
| Compound ID: | Y505-3397 |
| Compound Name: | N'-[(5-fluorothiophen-2-yl)methylidene]-1-methyl-1H-pyrazole-3-carbohydrazide |
| Molecular Weight: | 252.27 |
| Molecular Formula: | C10 H9 F N4 O S |
| Smiles: | Cn1ccc(C(N/N=C/c2ccc(F)s2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.7643 |
| logD: | 1.7634 |
| logSw: | -2.4791 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.265 |
| InChI Key: | IBMSUBQLWZYSAT-UHFFFAOYSA-N |