1-benzyl-4-(5-fluorothiophene-2-sulfonyl)piperazine
Chemical Structure Depiction of
1-benzyl-4-(5-fluorothiophene-2-sulfonyl)piperazine
1-benzyl-4-(5-fluorothiophene-2-sulfonyl)piperazine
Compound characteristics
| Compound ID: | Y505-3417 |
| Compound Name: | 1-benzyl-4-(5-fluorothiophene-2-sulfonyl)piperazine |
| Molecular Weight: | 340.44 |
| Molecular Formula: | C15 H17 F N2 O2 S2 |
| Smiles: | C1CN(CCN1Cc1ccccc1)S(c1ccc(F)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8119 |
| logD: | 2.8019 |
| logSw: | -3.1173 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.508 |
| InChI Key: | FBTAPQWIOWTKSU-UHFFFAOYSA-N |