N'-[(1-ethyl-5-fluoro-1H-pyrazol-4-yl)methylidene]-2-[(4-methylphenyl)sulfanyl]acetohydrazide
Chemical Structure Depiction of
N'-[(1-ethyl-5-fluoro-1H-pyrazol-4-yl)methylidene]-2-[(4-methylphenyl)sulfanyl]acetohydrazide
N'-[(1-ethyl-5-fluoro-1H-pyrazol-4-yl)methylidene]-2-[(4-methylphenyl)sulfanyl]acetohydrazide
Compound characteristics
| Compound ID: | Y505-3509 |
| Compound Name: | N'-[(1-ethyl-5-fluoro-1H-pyrazol-4-yl)methylidene]-2-[(4-methylphenyl)sulfanyl]acetohydrazide |
| Molecular Weight: | 320.39 |
| Molecular Formula: | C15 H17 F N4 O S |
| Smiles: | CCn1c(c(/C=N/NC(CSc2ccc(C)cc2)=O)cn1)F |
| Stereo: | ACHIRAL |
| logP: | 3.0398 |
| logD: | 3.0389 |
| logSw: | -3.0715 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.071 |
| InChI Key: | ANAYOAOAPFTVGY-UHFFFAOYSA-N |