2-[(5-fluorothiophen-2-yl)methyl]-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-[(5-fluorothiophen-2-yl)methyl]-1H-isoindole-1,3(2H)-dione
2-[(5-fluorothiophen-2-yl)methyl]-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | Y505-3744 |
| Compound Name: | 2-[(5-fluorothiophen-2-yl)methyl]-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 261.27 |
| Molecular Formula: | C13 H8 F N O2 S |
| Smiles: | C(c1ccc(F)s1)N1C(c2ccccc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9505 |
| logD: | 2.9505 |
| logSw: | -3.4528 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.5097 |
| InChI Key: | VAZWOFIXNDHNDK-UHFFFAOYSA-N |