3,4-dichloro-N'-[(5-fluorothiophen-2-yl)methylidene]benzohydrazide
Chemical Structure Depiction of
3,4-dichloro-N'-[(5-fluorothiophen-2-yl)methylidene]benzohydrazide
3,4-dichloro-N'-[(5-fluorothiophen-2-yl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | Y505-3976 |
| Compound Name: | 3,4-dichloro-N'-[(5-fluorothiophen-2-yl)methylidene]benzohydrazide |
| Molecular Weight: | 317.17 |
| Molecular Formula: | C12 H7 Cl2 F N2 O S |
| Smiles: | C(\c1ccc(F)s1)=N/NC(c1ccc(c(c1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.7388 |
| logD: | 4.4452 |
| logSw: | -5.1136 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.573 |
| InChI Key: | BHHFBXCWWGXEAF-UHFFFAOYSA-N |